CAS 943910-36-9 appears in our catalog under these names: 5-(3-Bromophenyl)oxazolidin-2-one, 95+%, 5-(3-Bromophenyl)oxazolidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg.
5-(3-bromophenyl)-1,3-oxazolidin-2-one (CAS 943910-36-9) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 5-(3-bromophenyl)-1,3-oxazolidin-2-one. InChIKey: KXRLLPOTYKCTOC-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 5-(3-bromophenyl)-1,3-oxazolidin-2-one |
| InChIKey | KXRLLPOTYKCTOC-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)N1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)