Products 944709-54-0
CAS 944709-54-0 is the registry number for 1-(3-Bromophenyl)-2,3-dihydro-1H-imidazol-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(3-bromophenyl)-1H-imidazol-2-one (CAS 944709-54-0) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 3-(3-bromophenyl)-1H-imidazol-2-one. InChIKey: GSEFYTRZEWBZFT-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 3-(3-bromophenyl)-1H-imidazol-2-one |
| InChIKey | GSEFYTRZEWBZFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)N2C=CNC2=O |
Computed by PubChem (NCBI)