Products 945978-37-0
CAS 945978-37-0 appears in our catalog under these names: 1-(3,4-Difluorophenyl)-2,2,2-trifluoroethanol, 95%, 95%, 1-(3,4-DIFLUOROPHENYL)-2,2,2-TRIFLUOROETHANOL, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(3,4-difluorophenyl)-2,2,2-trifluoroethanol (CAS 945978-37-0) is a chemical compound with the molecular formula C8H5F5O and a molecular weight of 212.12 g/mol. IUPAC name: 1-(3,4-difluorophenyl)-2,2,2-trifluoroethanol. InChIKey: JORHCERXDHSICF-UHFFFAOYSA-N.
| Molecular formula | C8H5F5O |
|---|---|
| Molecular weight | 212.12 g/mol |
| IUPAC name | 1-(3,4-difluorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | JORHCERXDHSICF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(F)(F)F)O)F)F |
Computed by PubChem (NCBI)