Products 946077-08-3
CAS 946077-08-3 is the registry number for MPT0B002. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1-methylindol-5-yl)-(3,4,5-trimethoxyphenyl)methanone (CAS 946077-08-3) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: (1-methylindol-5-yl)-(3,4,5-trimethoxyphenyl)methanone. InChIKey: ZACNDXXBCBNGMV-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (1-methylindol-5-yl)-(3,4,5-trimethoxyphenyl)methanone |
| InChIKey | ZACNDXXBCBNGMV-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C1C=CC(=C2)C(=O)C3=CC(=C(C(=C3)OC)OC)OC |
Computed by PubChem (NCBI)