Products 947150-13-2
CAS 947150-13-2 is the registry number for 2-(2-Chloroethyl)-4-methylbenzoyl Chloride, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(2-chloroethyl)-4-methylbenzoyl chloride (CAS 947150-13-2) is a chemical compound with the molecular formula C10H10Cl2O and a molecular weight of 217.09 g/mol. IUPAC name: 2-(2-chloroethyl)-4-methylbenzoyl chloride. InChIKey: GQHWEMVVCIHZOY-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | 2-(2-chloroethyl)-4-methylbenzoyl chloride |
| InChIKey | GQHWEMVVCIHZOY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)Cl)CCCl |
Computed by PubChem (NCBI)