CAS 948292-29-3 is the registry number for 4,5-Dichloro-8-methylquinoline, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4,5-dichloro-8-methylquinoline (CAS 948292-29-3) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 4,5-dichloro-8-methylquinoline. InChIKey: IYXRCWLZIIBTGX-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 4,5-dichloro-8-methylquinoline |
| InChIKey | IYXRCWLZIIBTGX-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Cl)C(=CC=N2)Cl |
Computed by PubChem (NCBI)