CAS 948550-13-8 appears in our catalog under these names: Formoterol Impurity 52, 1-(4-Hydroxy-2-nitrophenyl)ethanone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
1-(4-hydroxy-2-nitrophenyl)ethanone (CAS 948550-13-8) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 1-(4-hydroxy-2-nitrophenyl)ethanone. InChIKey: HTNRCZLQNNBJAT-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 1-(4-hydroxy-2-nitrophenyl)ethanone |
| InChIKey | HTNRCZLQNNBJAT-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)