CAS 950037-24-8 appears in our catalog under these names: 2-Chloro-4,7,8-trimethylquinoline, 95%, 2–chloro–4,7,8–trimethylquinoline, 2-chloro-4,7,8-trimethylquinoline, 98%, 98%, 2-chloro-4,7,8-trimethylquinoline, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g.
2-chloro-4,7,8-trimethylquinoline (CAS 950037-24-8) is a chemical compound with the molecular formula C12H12ClN and a molecular weight of 205.68 g/mol. IUPAC name: 2-chloro-4,7,8-trimethylquinoline. InChIKey: OSCHOKMWJQRQQL-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 2-chloro-4,7,8-trimethylquinoline |
| InChIKey | OSCHOKMWJQRQQL-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=CC(=N2)Cl)C)C |
Computed by PubChem (NCBI)