CAS 95060-80-3 is the registry number for 1-Benzyl-3-hydrazinylidene-2,3-dihydro-1H-indol-2-one. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
1-benzyl-3-diazenylindol-2-ol (CAS 95060-80-3) is a chemical compound with the molecular formula C15H13N3O and a molecular weight of 251.28 g/mol. IUPAC name: 1-benzyl-3-diazenylindol-2-ol. InChIKey: BVXUVNCJYYVIQH-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 1-benzyl-3-diazenylindol-2-ol |
| InChIKey | BVXUVNCJYYVIQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3C(=C2O)N=N |
Computed by PubChem (NCBI)