Products 95299-69-7

CAS 95299-69-7 appears in our catalog under these names: 2-(3-Fluorophenoxy)acetyl chloride, 95%, 2-(3-Fluorophenoxy)acetyl Chloride 95%, 2-(3-Fluorophenoxy)acetyl Chloride, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-fluorophenoxy)acetyl chloride (CAS 95299-69-7) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 2-(3-fluorophenoxy)acetyl chloride. InChIKey: NEYIIDYMXSZXSP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClFO2
Molecular weight188.58 g/mol
IUPAC name2-(3-fluorophenoxy)acetyl chloride
InChIKeyNEYIIDYMXSZXSP-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)F)OCC(=O)Cl

Computed by PubChem (NCBI)