Products 953715-71-4
CAS 953715-71-4 is the registry number for (6-(4-Phenoxyphenoxy)pyridin-3-yl)methanamine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[6-(4-phenoxyphenoxy)-3-pyridinyl]methanamine (CAS 953715-71-4) is a chemical compound with the molecular formula C18H16N2O2 and a molecular weight of 292.3 g/mol. IUPAC name: [6-(4-phenoxyphenoxy)-3-pyridinyl]methanamine. InChIKey: PNACMKDILPQCBO-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O2 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | [6-(4-phenoxyphenoxy)-3-pyridinyl]methanamine |
| InChIKey | PNACMKDILPQCBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)OC3=NC=C(C=C3)CN |
Computed by PubChem (NCBI)