Products 95403-16-0

CAS 95403-16-0 is the registry number for Farrerol. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 250mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethyl-2,3-dihydrochromen-4-one (CAS 95403-16-0) is a chemical compound with the molecular formula C17H16O5 and a molecular weight of 300.30 g/mol. IUPAC name: 5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethyl-2,3-dihydrochromen-4-one. InChIKey: DYHOLQACRGJEHX-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16O5
Molecular weight300.30 g/mol
IUPAC name5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethyl-2,3-dihydrochromen-4-one
InChIKeyDYHOLQACRGJEHX-UHFFFAOYSA-N
SMILESCC1=C(C(=C2C(=C1O)C(=O)CC(O2)C3=CC=C(C=C3)O)C)O

Computed by PubChem (NCBI)