CAS 95403-16-0 is the registry number for Farrerol. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 250mg, 25mg, 50mg.
5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethyl-2,3-dihydrochromen-4-one (CAS 95403-16-0) is a chemical compound with the molecular formula C17H16O5 and a molecular weight of 300.30 g/mol. IUPAC name: 5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethyl-2,3-dihydrochromen-4-one. InChIKey: DYHOLQACRGJEHX-UHFFFAOYSA-N.
| Molecular formula | C17H16O5 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethyl-2,3-dihydrochromen-4-one |
| InChIKey | DYHOLQACRGJEHX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C2C(=C1O)C(=O)CC(O2)C3=CC=C(C=C3)O)C)O |
Computed by PubChem (NCBI)