CAS 954325-79-2 appears in our catalog under these names: 2-Methyl-5-(4h-1,2,4-triazol-4-yl)aniline, 95%, 2-Methyl-5-(4H-1,2,4-triazol-4-yl)aniline, 95+%, 2-Methyl-5-(4H-1,2,4-triazol-4-yl)aniline, 95%+, 95%+. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg.
2-methyl-5-(1,2,4-triazol-4-yl)aniline (CAS 954325-79-2) is a chemical compound with the molecular formula C9H10N4 and a molecular weight of 174.20 g/mol. IUPAC name: 2-methyl-5-(1,2,4-triazol-4-yl)aniline. InChIKey: UBLNKOFEAKDINI-UHFFFAOYSA-N.
| Molecular formula | C9H10N4 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 2-methyl-5-(1,2,4-triazol-4-yl)aniline |
| InChIKey | UBLNKOFEAKDINI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C=NN=C2)N |
Computed by PubChem (NCBI)