CAS 956010-87-0 appears in our catalog under these names: 3–(Trifluoromethyl)–1H–pyrazolo(3,4–b)pyridine, 3-(Trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine, 95%, 95%, 3-(TRIFLUOROMETHYL)-1H-PYRAZOLO[3,4-B]PYRIDINE, 95%, 3-(Trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 1g, 25g, 250mg.
3-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine (CAS 956010-87-0) is a chemical compound with the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. IUPAC name: 3-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine. InChIKey: TVDKAMJFPZJIKB-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 3-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine |
| InChIKey | TVDKAMJFPZJIKB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2N=C1)C(F)(F)F |
Computed by PubChem (NCBI)