CAS 956950-98-4 is the registry number for 2-(4-Chloro-3,5-dimethyl-pyrazol-1-yl)-propionic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(4-chloro-3,5-dimethylpyrazol-1-yl)propanoic acid (CAS 956950-98-4) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: 2-(4-chloro-3,5-dimethylpyrazol-1-yl)propanoic acid. InChIKey: ZFBIVBZRAMXENI-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 2-(4-chloro-3,5-dimethylpyrazol-1-yl)propanoic acid |
| InChIKey | ZFBIVBZRAMXENI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C(C)C(=O)O)C)Cl |
Computed by PubChem (NCBI)