Products 956950-98-4

CAS 956950-98-4 is the registry number for 2-(4-Chloro-3,5-dimethyl-pyrazol-1-yl)-propionic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-(4-chloro-3,5-dimethylpyrazol-1-yl)propanoic acid (CAS 956950-98-4) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: 2-(4-chloro-3,5-dimethylpyrazol-1-yl)propanoic acid. InChIKey: ZFBIVBZRAMXENI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11ClN2O2
Molecular weight202.64 g/mol
IUPAC name2-(4-chloro-3,5-dimethylpyrazol-1-yl)propanoic acid
InChIKeyZFBIVBZRAMXENI-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1C(C)C(=O)O)C)Cl

Computed by PubChem (NCBI)