Products 956984-87-5
CAS 956984-87-5 is the registry number for 1-(4-Fluorophenyl)-3-(3-methoxyphenyl)-1H-pyrazole-4-carbaldehyde. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(4-fluorophenyl)-3-(3-methoxyphenyl)pyrazole-4-carbaldehyde (CAS 956984-87-5) is a chemical compound with the molecular formula C17H13FN2O2 and a molecular weight of 296.29 g/mol. IUPAC name: 1-(4-fluorophenyl)-3-(3-methoxyphenyl)pyrazole-4-carbaldehyde. InChIKey: PLMYCIIOLUHFFW-UHFFFAOYSA-N.
| Molecular formula | C17H13FN2O2 |
|---|---|
| Molecular weight | 296.29 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-3-(3-methoxyphenyl)pyrazole-4-carbaldehyde |
| InChIKey | PLMYCIIOLUHFFW-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NN(C=C2C=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)