Products 957061-16-4
CAS 957061-16-4 is the registry number for 2-N,N-Diethylsulfamoylphenylboronic acid, 98%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g.
[2-(diethylsulfamoyl)phenyl]boronic acid (CAS 957061-16-4) is a chemical compound with the molecular formula C10H16BNO4S and a molecular weight of 257.12 g/mol. IUPAC name: [2-(diethylsulfamoyl)phenyl]boronic acid. InChIKey: DJGWUWODZFKVIY-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO4S |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | [2-(diethylsulfamoyl)phenyl]boronic acid |
| InChIKey | DJGWUWODZFKVIY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1S(=O)(=O)N(CC)CC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-N,N-Diethylsulfamoylphenylboronic acid, N,N-Diethyl 2-boronobenzenesulfonamide, [2-(diethylsulfamoyl)phenyl]boronic acid, (2-(N,N-Diethylsulfamoyl)phenyl)boronic acid, 2-(N,N-diethylsulfamoyl)phenylboronic acid, 2-N,N-Diethylsulfamoylphenylboronicacid, 2-N,N-DiethyL, 2-(N,N-Diethylsulfamoyl)benzeneboronic acid, 2-(N,N-diethylsulfamoyl)phenylboronic acid USP/EP/BP, Boronic acid, B-[2-[(diethylamino)sulfonyl]phenyl]-