Products 957121-09-4
CAS 957121-09-4 is the registry number for (2-Bromo-6-fluoro-3-methylphenyl)boronic acid, 97%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 5g, 10g, 25g, 1g, 50g, 100g.
(2-bromo-6-fluoro-3-methylphenyl)boronic acid (CAS 957121-09-4) is a chemical compound with the molecular formula C7H7BBrFO2 and a molecular weight of 232.84 g/mol. IUPAC name: (2-bromo-6-fluoro-3-methylphenyl)boronic acid. InChIKey: DJJQBIXFCLTFQS-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrFO2 |
|---|---|
| Molecular weight | 232.84 g/mol |
| IUPAC name | (2-bromo-6-fluoro-3-methylphenyl)boronic acid |
| InChIKey | DJJQBIXFCLTFQS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Br)C)F)(O)O |
Computed by PubChem (NCBI)