Products 957206-36-9
CAS 957206-36-9 is the registry number for Methyl 4-bromo-3-(trifluoromethoxy)benzoate, ≥99.7%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Methyl 4-bromo-3-(trifluoromethoxy)benzoate (CAS 957206-36-9) is a chemical compound with the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. IUPAC name: methyl 4-bromo-3-(trifluoromethoxy)benzoate. InChIKey: XIKGXGNARLJTEO-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O3 |
|---|---|
| Molecular weight | 299.04 g/mol |
| IUPAC name | methyl 4-bromo-3-(trifluoromethoxy)benzoate |
| InChIKey | XIKGXGNARLJTEO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Br)OC(F)(F)F |
Computed by PubChem (NCBI)