CAS 957312-71-9 appears in our catalog under these names: 5-(1,5-Dimethyl-1h-pyrazol-4-yl)isoxazole-3-carboxylic acid, 95%, 5-(1,5-Dimethyl-1H-pyrazol-4-yl)-isoxazole-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 2,5g.
5-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid (CAS 957312-71-9) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: 5-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: NYHSVIQOOWQYNS-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 5-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | NYHSVIQOOWQYNS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)