Products 957472-01-4

CAS 957472-01-4 is the registry number for Ethyl 2-(3-piperidinylidene)acetate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Ethyl (2E)-2-piperidin-3-ylideneacetate;hydrochloride (CAS 957472-01-4) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: ethyl (2E)-2-piperidin-3-ylideneacetate;hydrochloride. InChIKey: GFIJKQHMXNKETO-WVLIHFOGSA-N.

Identity
Molecular formulaC9H16ClNO2
Molecular weight205.68 g/mol
IUPAC nameethyl (2E)-2-piperidin-3-ylideneacetate;hydrochloride
InChIKeyGFIJKQHMXNKETO-WVLIHFOGSA-N
SMILESCCOC(=O)/C=C/1\CCCNC1.Cl

Computed by PubChem (NCBI)