Products 565456-77-1
CAS 565456-77-1 appears in our catalog under these names: Methyl (1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate hydrochloride, 96%, Nirmatrelvir Impurity 29 HCl, (1R,2S,5S)-6,6-Dimethyl-3-azabicyclo(3.1.0)hexane-2-carboxylic acid methyl ester hydrochloride, Boceprevir InterMediates 96%, (1R,2S,5S)-Methyl 6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate Hydrochloride, 99%, 99%. Offered by: Combi-blocks, Chemat Brand, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 25g, on request, 0,002kg, 0,001kg, 0,005kg.
Methyl (1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate;hydrochloride (CAS 565456-77-1) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: methyl (1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate;hydrochloride. InChIKey: FKVUDBWXNAFSPB-MKXDVQRUSA-N.
| Molecular formula | C9H16ClNO2 |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | methyl (1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate;hydrochloride |
| InChIKey | FKVUDBWXNAFSPB-MKXDVQRUSA-N |
| SMILES | CC1([C@@H]2[C@H]1[C@H](NC2)C(=O)OC)C.Cl |
Computed by PubChem (NCBI)