Products 1255717-51-1

CAS 1255717-51-1 is the registry number for 3-(2-Azabicyclo[2.2.1]hept-2-yl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

3-(2-azabicyclo[2.2.1]heptan-2-yl)propanoic acid;hydrochloride (CAS 1255717-51-1) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: 3-(2-azabicyclo[2.2.1]heptan-2-yl)propanoic acid;hydrochloride. InChIKey: UASVELAIOACPFO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16ClNO2
Molecular weight205.68 g/mol
IUPAC name3-(2-azabicyclo[2.2.1]heptan-2-yl)propanoic acid;hydrochloride
InChIKeyUASVELAIOACPFO-UHFFFAOYSA-N
SMILESC1CC2CC1CN2CCC(=O)O.Cl

Computed by PubChem (NCBI)