Products 350015-75-7
CAS 350015-75-7 appears in our catalog under these names: Cis-(z)-8-amino-cyclooct-4-enecarboxylic acid hydrochloride, 95%, cis-8-Aminocyclooct-4-ene-COOH*HCl. Offered by: Combi-blocks, AmBeed, Iris Biotech. Available pack sizes: 1g, 5g, 250mg.
(1R,4Z,8S)-8-aminocyclooct-4-ene-1-carboxylic acid;hydrochloride (CAS 350015-75-7) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: (1R,4Z,8S)-8-aminocyclooct-4-ene-1-carboxylic acid;hydrochloride. InChIKey: HNWWZTQTDPQDDI-IWDMMDDHSA-N.
| Molecular formula | C9H16ClNO2 |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | (1R,4Z,8S)-8-aminocyclooct-4-ene-1-carboxylic acid;hydrochloride |
| InChIKey | HNWWZTQTDPQDDI-IWDMMDDHSA-N |
| SMILES | C/1C[C@H]([C@H](CC/C=C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)