Products 75208-56-9

CAS 75208-56-9 appears in our catalog under these names: 2-(1-Azabicyclo[2.2.2]octan-3-yl)acetic acid hydrochloride, 95%, 2-{1-azabicyclo(2.2.2)octan-3-yl}acetic acid hydrochloride, 2-(Quinuclidin-3-yl)acetic acid hydrochloride 95%, 2-{1-azabicyclo[2.2.2]octan-3-yl}acetic acid hydrochloride, 95%, 95%, 2-(Quinuclidin-3-yl)acetic acid hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 0,5g, 100mg.

Structural formula: {0} (CAS {1})

2-(1-azabicyclo[2.2.2]octan-3-yl)acetic acid;hydrochloride (CAS 75208-56-9) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: 2-(1-azabicyclo[2.2.2]octan-3-yl)acetic acid;hydrochloride. InChIKey: HCMSYUHZEXYCNS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16ClNO2
Molecular weight205.68 g/mol
IUPAC name2-(1-azabicyclo[2.2.2]octan-3-yl)acetic acid;hydrochloride
InChIKeyHCMSYUHZEXYCNS-UHFFFAOYSA-N
SMILESC1CN2CCC1C(C2)CC(=O)O.Cl

Computed by PubChem (NCBI)