Products 2361733-92-6

CAS 2361733-92-6 is the registry number for 7-Azaspiro[3.5]nonane-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

7-azaspiro[3.5]nonane-2-carboxylic acid;hydrochloride (CAS 2361733-92-6) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: 7-azaspiro[3.5]nonane-2-carboxylic acid;hydrochloride. InChIKey: RWTSJYDSOYVSFY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16ClNO2
Molecular weight205.68 g/mol
IUPAC name7-azaspiro[3.5]nonane-2-carboxylic acid;hydrochloride
InChIKeyRWTSJYDSOYVSFY-UHFFFAOYSA-N
SMILESC1CNCCC12CC(C2)C(=O)O.Cl

Computed by PubChem (NCBI)