CAS 957487-34-2 is the registry number for 3-(1-Ethyl-1H-pyrazol-4-yl)isoxazole-5-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g.
3-(1-ethylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid (CAS 957487-34-2) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: 3-(1-ethylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid. InChIKey: QPEZKZWHJPOPDX-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 3-(1-ethylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | QPEZKZWHJPOPDX-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C=N1)C2=NOC(=C2)C(=O)O |
Computed by PubChem (NCBI)