CAS 95881-25-7 is the registry number for 4-(Pentafluoroethyl)phenol, 98%. Offered by: AmBeed. Available pack sizes: 1g.
4-(1,1,2,2,2-pentafluoroethyl)phenol (CAS 95881-25-7) is a chemical compound with the molecular formula C8H5F5O and a molecular weight of 212.12 g/mol. IUPAC name: 4-(1,1,2,2,2-pentafluoroethyl)phenol. InChIKey: PWCUFRXPNILGHF-UHFFFAOYSA-N.
| Molecular formula | C8H5F5O |
|---|---|
| Molecular weight | 212.12 g/mol |
| IUPAC name | 4-(1,1,2,2,2-pentafluoroethyl)phenol |
| InChIKey | PWCUFRXPNILGHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)(F)F)O |
Computed by PubChem (NCBI)