Products 959236-89-6

CAS 959236-89-6 is the registry number for 1-Fmoc-3-azetidine acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[1-(9H-fluoren-9-ylmethoxycarbonyl)azetidin-3-yl]acetic acid (CAS 959236-89-6) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: 2-[1-(9H-fluoren-9-ylmethoxycarbonyl)azetidin-3-yl]acetic acid. InChIKey: RKRHXPLYZMPRAA-UHFFFAOYSA-N.

Identity
Molecular formulaC20H19NO4
Molecular weight337.4 g/mol
IUPAC name2-[1-(9H-fluoren-9-ylmethoxycarbonyl)azetidin-3-yl]acetic acid
InChIKeyRKRHXPLYZMPRAA-UHFFFAOYSA-N
SMILESC1C(CN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)CC(=O)O

Computed by PubChem (NCBI)