CAS 959240-51-8 appears in our catalog under these names: 2-Chloro-4-(3-methyl-1,2,4-oxadiazol-5-yl)pyridine, 95%, 2-Chloro-4-(3-methyl-1,2,4-oxadiazol-5-yl)pyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2,5g.
5-(2-chloro-4-pyridinyl)-3-methyl-1,2,4-oxadiazole (CAS 959240-51-8) is a chemical compound with the molecular formula C8H6ClN3O and a molecular weight of 195.60 g/mol. IUPAC name: 5-(2-chloro-4-pyridinyl)-3-methyl-1,2,4-oxadiazole. InChIKey: PGOOYEJYEUZJBF-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 5-(2-chloro-4-pyridinyl)-3-methyl-1,2,4-oxadiazole |
| InChIKey | PGOOYEJYEUZJBF-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2=CC(=NC=C2)Cl |
Computed by PubChem (NCBI)