CAS 959617-54-0 is the registry number for 5-(Furan-2-yl)oxazole-2-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(furan-2-yl)-1,3-oxazole-2-carbaldehyde (CAS 959617-54-0) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 5-(furan-2-yl)-1,3-oxazole-2-carbaldehyde. InChIKey: COUGAKGZEBIWIK-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 5-(furan-2-yl)-1,3-oxazole-2-carbaldehyde |
| InChIKey | COUGAKGZEBIWIK-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CN=C(O2)C=O |
Computed by PubChem (NCBI)