Products 959864-55-2
CAS 959864-55-2 is the registry number for 4-(4-Acetylphenyl)-1,2,4-triazolidine-3,5-dione, 97%,RG. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 25g.
4-(4-acetylphenyl)-1,2,4-triazolidine-3,5-dione (CAS 959864-55-2) is a chemical compound with the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. IUPAC name: 4-(4-acetylphenyl)-1,2,4-triazolidine-3,5-dione. InChIKey: LKDPJIGWTPEUEZ-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O3 |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | 4-(4-acetylphenyl)-1,2,4-triazolidine-3,5-dione |
| InChIKey | LKDPJIGWTPEUEZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)N2C(=O)NNC2=O |
Computed by PubChem (NCBI)