Products 959990-35-3
CAS 959990-35-3 appears in our catalog under these names: 2,4-Dichloro-6-methoxy-1,5-naphthyridine, 97%, 97%, 2,4-Dichloro-6-methoxy-1,5-naphthyridine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,4-dichloro-6-methoxy-1,5-naphthyridine (CAS 959990-35-3) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 2,4-dichloro-6-methoxy-1,5-naphthyridine. InChIKey: OBZCWYVPSYGAPU-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2,4-dichloro-6-methoxy-1,5-naphthyridine |
| InChIKey | OBZCWYVPSYGAPU-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)