cas: 97-08-5 — see every product listed under this CAS number, including other names
4-Chloro-3-nitrobenzenesulfonyl Chloride 95% (CAS 97-08-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A419747-1g |
| cas | 97-08-5 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 153.44 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 381.50 Pln | |
| Ambeed | 500g | 1171.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A419747 |
4-chloro-3-nitrobenzenesulfonyl chloride (CAS 97-08-5) is a chemical compound with the molecular formula C6H3Cl2NO4S and a molecular weight of 256.06 g/mol. IUPAC name: 4-chloro-3-nitrobenzenesulfonyl chloride. InChIKey: SEWNAJIUKSTYOP-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO4S |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 4-chloro-3-nitrobenzenesulfonyl chloride |
| InChIKey | SEWNAJIUKSTYOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)