CAS 97901-22-9 is the registry number for Nafagrel (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(imidazol-1-ylmethyl)-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid;hydrochloride (CAS 97901-22-9) is a chemical compound with the molecular formula C15H17ClN2O2 and a molecular weight of 292.76 g/mol. IUPAC name: 6-(imidazol-1-ylmethyl)-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid;hydrochloride. InChIKey: DRWRJLPMUWWEHY-UHFFFAOYSA-N.
| Molecular formula | C15H17ClN2O2 |
|---|---|
| Molecular weight | 292.76 g/mol |
| IUPAC name | 6-(imidazol-1-ylmethyl)-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid;hydrochloride |
| InChIKey | DRWRJLPMUWWEHY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1CN3C=CN=C3)C=CC(=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)