CAS 98416-69-4 is the registry number for 6-Bromo-3-methyl-1,2-dihydroquinoxalin-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-bromo-3-methyl-1H-quinoxalin-2-one (CAS 98416-69-4) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 6-bromo-3-methyl-1H-quinoxalin-2-one. InChIKey: CDCJBVBBXZSTRF-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 6-bromo-3-methyl-1H-quinoxalin-2-one |
| InChIKey | CDCJBVBBXZSTRF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC(=C2)Br)NC1=O |
Computed by PubChem (NCBI)