CAS 98623-15-5 is the registry number for N-Methyl-4-nitrobenzeneethanesulfonamide. Offered by: TRC. Available pack sizes: 5g.
N-methyl-2-(4-nitrophenyl)ethanesulfonamide (CAS 98623-15-5) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: N-methyl-2-(4-nitrophenyl)ethanesulfonamide. InChIKey: KUSZKCQLQFNLOF-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | N-methyl-2-(4-nitrophenyl)ethanesulfonamide |
| InChIKey | KUSZKCQLQFNLOF-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)CCC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)