CAS 98700-53-9 appears in our catalog under these names: 1,5–Diphenyl–1H–pyrazole–4–carboxylic acid, 1,5-Diphenyl-1H-pyrazole-4-carboxylic acid, 95%, 95%, 1,5-Diphenyl-1H-pyrazole-4-carboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
1,5-diphenylpyrazole-4-carboxylic acid (CAS 98700-53-9) is a chemical compound with the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. IUPAC name: 1,5-diphenylpyrazole-4-carboxylic acid. InChIKey: XFYHUVOWHZCRFB-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 1,5-diphenylpyrazole-4-carboxylic acid |
| InChIKey | XFYHUVOWHZCRFB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=NN2C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)