CAS 98953-81-2 appears in our catalog under these names: 5,6-Diamino-1,3-dimethyl-2,3-dihydro-1H-1,3-benzodiazol-2-one, 95%, 5,6-Diamino-1,3-dimethyl-2,3-dihydro-1H-1,3-benzodiazol-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5,6-diamino-1,3-dimethylbenzimidazol-2-one (CAS 98953-81-2) is a chemical compound with the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. IUPAC name: 5,6-diamino-1,3-dimethylbenzimidazol-2-one. InChIKey: FKJSPUMLLOWMNP-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O |
|---|---|
| Molecular weight | 192.22 g/mol |
| IUPAC name | 5,6-diamino-1,3-dimethylbenzimidazol-2-one |
| InChIKey | FKJSPUMLLOWMNP-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C(=C2)N)N)N(C1=O)C |
Computed by PubChem (NCBI)