CAS 99056-23-2 appears in our catalog under these names: (6-Ethoxy-1,3-benzothiazol-2-yl)urea, (6-Ethoxy-1,3-benzothiazol-2-yl)urea, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.
(6-ethoxy-1,3-benzothiazol-2-yl)urea (CAS 99056-23-2) is a chemical compound with the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. IUPAC name: (6-ethoxy-1,3-benzothiazol-2-yl)urea. InChIKey: IFDKYGFRLNFSIX-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | (6-ethoxy-1,3-benzothiazol-2-yl)urea |
| InChIKey | IFDKYGFRLNFSIX-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)N=C(S2)NC(=O)N |
Computed by PubChem (NCBI)