Products 99208-38-5
CAS 99208-38-5 appears in our catalog under these names: Beta-Hydroxy-O-(phenylmethyl)tyrosine, b-Hydroxy-O-(phenylmethyl)tyrosine. Offered by: TRC. Available pack sizes: 0,5mg, 1mg, 2,5mg.
2-amino-3-hydroxy-3-(4-phenylmethoxyphenyl)propanoic acid (CAS 99208-38-5) is a chemical compound with the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. IUPAC name: 2-amino-3-hydroxy-3-(4-phenylmethoxyphenyl)propanoic acid. InChIKey: FKMWWQBDFKUJNL-UHFFFAOYSA-N.
| Molecular formula | C16H17NO4 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | 2-amino-3-hydroxy-3-(4-phenylmethoxyphenyl)propanoic acid |
| InChIKey | FKMWWQBDFKUJNL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C(C(C(=O)O)N)O |
Computed by PubChem (NCBI)