CAS 99359-32-7 appears in our catalog under these names: H–Phe(4–Br)–Ome·HCl, H-Phe(4-Br)-Ome.HCl, 97%, 97%, (S)-Methyl 2-amino-3-(4-bromophenyl)propanoate hydrochloride, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 100g, 50g.
Methyl (2S)-2-amino-3-(4-bromophenyl)propanoate;hydrochloride (CAS 99359-32-7) is a chemical compound with the molecular formula C10H13BrClNO2 and a molecular weight of 294.57 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-bromophenyl)propanoate;hydrochloride. InChIKey: MCYQWPUGHHRKME-FVGYRXGTSA-N.
| Molecular formula | C10H13BrClNO2 |
|---|---|
| Molecular weight | 294.57 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-bromophenyl)propanoate;hydrochloride |
| InChIKey | MCYQWPUGHHRKME-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)