CAS 1197825-07-2 appears in our catalog under these names: Methyl 3-amino-3-(3-bromophenyl)propanoate hydrochloride, 95%, Methyl 3-amino-3-(3-bromophenyl)propanoate hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
Methyl 3-amino-3-(3-bromophenyl)propanoate;hydrochloride (CAS 1197825-07-2) is a chemical compound with the molecular formula C10H13BrClNO2 and a molecular weight of 294.57 g/mol. IUPAC name: methyl 3-amino-3-(3-bromophenyl)propanoate;hydrochloride. InChIKey: PKCPLSGPTCTEMS-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClNO2 |
|---|---|
| Molecular weight | 294.57 g/mol |
| IUPAC name | methyl 3-amino-3-(3-bromophenyl)propanoate;hydrochloride |
| InChIKey | PKCPLSGPTCTEMS-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=CC(=CC=C1)Br)N.Cl |
Computed by PubChem (NCBI)