CAS 1245606-63-6 appears in our catalog under these names: (S)-Methyl 3-amino-3-(4-bromophenyl)propanoate hydrochloride, 95%, (S)–Methyl 3–amino–3–(4–bromophenyl)propanoate hydrochloride, (S)-Methyl 3-amino-3-(4-bromophenyl)propanoate hydrochloride, 95%, 95%, (S)-Methyl 3-amino-3-(4-bromophenyl)propanoate hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
Methyl (3S)-3-amino-3-(4-bromophenyl)propanoate;hydrochloride (CAS 1245606-63-6) is a chemical compound with the molecular formula C10H13BrClNO2 and a molecular weight of 294.57 g/mol. IUPAC name: methyl (3S)-3-amino-3-(4-bromophenyl)propanoate;hydrochloride. InChIKey: KCAPQHNPIIVGSF-FVGYRXGTSA-N.
| Molecular formula | C10H13BrClNO2 |
|---|---|
| Molecular weight | 294.57 g/mol |
| IUPAC name | methyl (3S)-3-amino-3-(4-bromophenyl)propanoate;hydrochloride |
| InChIKey | KCAPQHNPIIVGSF-FVGYRXGTSA-N |
| SMILES | COC(=O)C[C@@H](C1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)