CAS 845908-98-7 appears in our catalog under these names: (R)-Methyl 3-amino-3-(4-bromophenyl)propanoate hydrochloride, 95%, Methyl (3R)-3-amino-3-(4-bromophenyl)propanoate hydrochloride, H-β-D-Phe(4-Br)-OMe HCl 95%, (R)-Methyl 3-amino-3-(4-bromophenyl)propanoate hydrochloride, 95%, 95%, (R)-METHYL 3-AMINO-3-(4-BROMOPHENYL)PROPANOATE HCL, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 0,5g.
Methyl (3R)-3-amino-3-(4-bromophenyl)propanoate;hydrochloride (CAS 845908-98-7) is a chemical compound with the molecular formula C10H13BrClNO2 and a molecular weight of 294.57 g/mol. IUPAC name: methyl (3R)-3-amino-3-(4-bromophenyl)propanoate;hydrochloride. InChIKey: KCAPQHNPIIVGSF-SBSPUUFOSA-N.
| Molecular formula | C10H13BrClNO2 |
|---|---|
| Molecular weight | 294.57 g/mol |
| IUPAC name | methyl (3R)-3-amino-3-(4-bromophenyl)propanoate;hydrochloride |
| InChIKey | KCAPQHNPIIVGSF-SBSPUUFOSA-N |
| SMILES | COC(=O)C[C@H](C1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)