CAS 331763-73-6 appears in our catalog under these names: (R)-3-Amino-4-(4-bromo-phenyl)-butyric acid hydrochloride, 98%, (R)–3–Amino–4–(4–bromophenyl)butanoic acid hydrochloride, 4-Bromo-D-beta-homophenylalanine hydrochloride, (R)-3-Amino-4-(4-bromophenyl)butanoic acid hydrochloride, 97%, 97%, (R)-3-Amino-4-(4-bromophenyl)butanoic acid hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 2g, 10g.
(3R)-3-amino-4-(4-bromophenyl)butanoic acid;hydrochloride (CAS 331763-73-6) is a chemical compound with the molecular formula C10H13BrClNO2 and a molecular weight of 294.57 g/mol. IUPAC name: (3R)-3-amino-4-(4-bromophenyl)butanoic acid;hydrochloride. InChIKey: QMUGXLUXLGZZSC-SBSPUUFOSA-N.
| Molecular formula | C10H13BrClNO2 |
|---|---|
| Molecular weight | 294.57 g/mol |
| IUPAC name | (3R)-3-amino-4-(4-bromophenyl)butanoic acid;hydrochloride |
| InChIKey | QMUGXLUXLGZZSC-SBSPUUFOSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](CC(=O)O)N)Br.Cl |
Computed by PubChem (NCBI)