CAS 403661-76-7 appears in our catalog under these names: (S)-3-Amino-4-(2-bromo-phenyl)-butyric acid hydrochloride, 95%, (S)-3-Amino-4-(2-bromophenyl)butanoic acid hydrochloride, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(3S)-3-amino-4-(2-bromophenyl)butanoic acid;hydrochloride (CAS 403661-76-7) is a chemical compound with the molecular formula C10H13BrClNO2 and a molecular weight of 294.57 g/mol. IUPAC name: (3S)-3-amino-4-(2-bromophenyl)butanoic acid;hydrochloride. InChIKey: CKWDUSDZVLBMMD-QRPNPIFTSA-N.
| Molecular formula | C10H13BrClNO2 |
|---|---|
| Molecular weight | 294.57 g/mol |
| IUPAC name | (3S)-3-amino-4-(2-bromophenyl)butanoic acid;hydrochloride |
| InChIKey | CKWDUSDZVLBMMD-QRPNPIFTSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](CC(=O)O)N)Br.Cl |
Computed by PubChem (NCBI)