Products 99844-15-2

CAS 99844-15-2 is the registry number for 4-(5-Amino-3-methyl-1H-pyrazol-1-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

4-(5-amino-3-methylpyrazol-1-yl)benzoic acid (CAS 99844-15-2) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: 4-(5-amino-3-methylpyrazol-1-yl)benzoic acid. InChIKey: DNROOKGPZRAQNG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11N3O2
Molecular weight217.22 g/mol
IUPAC name4-(5-amino-3-methylpyrazol-1-yl)benzoic acid
InChIKeyDNROOKGPZRAQNG-UHFFFAOYSA-N
SMILESCC1=NN(C(=C1)N)C2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)