CAS 99972-47-1 appears in our catalog under these names: 3-Amino-5-phenylthiophene-2-carboxylic acid, 96%, 3-Amino-5-phenylthiophene-2-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
3-amino-5-phenylthiophene-2-carboxylic acid (CAS 99972-47-1) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: 3-amino-5-phenylthiophene-2-carboxylic acid. InChIKey: CADPUALMFMAHDY-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 3-amino-5-phenylthiophene-2-carboxylic acid |
| InChIKey | CADPUALMFMAHDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(S2)C(=O)O)N |
Computed by PubChem (NCBI)