cas: 917099-02-6 — see every product listed under this CAS number, including other names
rel-1-(9H-Fluoren-9-ylmethyl) (2R,4S)-4-hydroxy-1,2-piperidinedicarboxylate, 95%, 95% (CAS 917099-02-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GXEZ-100mg |
| cas | 917099-02-6 |
| size | 100mg |
| availability | 1.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 765.20 Pln | |
| Chemat | 250mg | 1475.60 Pln | |
| Chemat | 1g | 4312.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypiperidine-2-carboxylic acid (CAS 917099-02-6) is a chemical compound with the molecular formula C21H21NO5 and a molecular weight of 367.4 g/mol. IUPAC name: (2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypiperidine-2-carboxylic acid. InChIKey: CJGSLUBWMLBOFZ-ORAYPTAESA-N.
| Molecular formula | C21H21NO5 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypiperidine-2-carboxylic acid |
| InChIKey | CJGSLUBWMLBOFZ-ORAYPTAESA-N |
| SMILES | C1CN([C@H](C[C@H]1O)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)